C19H18N6NaO5S3 — CID 175927033
CID 175927033 (PubChem CID 175927033) has the molecular formula C19H18N6NaO5S3 and a molecular weight of 529.58 g/mol.
| Compound Name | CID 175927033 |
|---|---|
| PubChem CID | 175927033 |
| Molecular Formula | C19H18N6NaO5S3 |
| Molecular Weight | 529.58 g/mol |
| Exact Mass | 529.04 |
| IUPAC Name | — |
| SMILES | CO/N=C(\C(=O)NC1C(=O)N2C(C(=O)O)C(/C=C/c3scnc3C)=CSC12)c1csc(N)n1.[Na] |
| InChI | InChI=1S/C19H18N6O5S3.Na/c1-8-11(33-7-21-8)4-3-9-5-31-17-13(16(27)25(17)14(9)18(28)29)23-15(26)12(24-30-2)10-6-32-19(20)22-10;/h3-7,13-14,17H,1-2H3,(H2,20,22)(H,23,26)(H,28,29);/b4-3+,24-12-; |
| InChIKey | AYASYEZXRTXRED-CHWMGZEMSA-N |
| XLogP | 0.91 |
| TPSA | 160.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.58 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|