C16H20ClN5O7S2 — CID 150140515
ethyl (2S,3S)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-1-methoxy-2-methylsulfanyl-4-oxoazetidine-2-carboxylate (PubChem CID 150140515) has the molecular formula C16H20ClN5O7S2 and a molecular weight of 493.95 g/mol. Its IUPAC name is ethyl (2S,3S)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-1-methoxy-2-methylsulfanyl-4-oxoazetidine-2-carboxylate.
| Compound Name | ethyl (2S,3S)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-1-methoxy-2-methylsulfanyl-4-oxoazetidine-2-carboxylate |
|---|---|
| PubChem CID | 150140515 |
| Molecular Formula | C16H20ClN5O7S2 |
| Molecular Weight | 493.95 g/mol |
| Exact Mass | 493.05 |
| IUPAC Name | ethyl (2S,3S)-3-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-1-methoxy-2-methylsulfanyl-4-oxoazetidine-2-carboxylate |
| SMILES | CCOC(=O)[C@@]1(SC)[C@@H](NC(=O)C(=NOC)c2csc(NC(=O)CCl)n2)C(=O)N1OC |
| InChI | InChI=1S/C16H20ClN5O7S2/c1-5-29-14(26)16(30-4)11(13(25)22(16)28-3)20-12(24)10(21-27-2)8-7-31-15(18-8)19-9(23)6-17/h7,11H,5-6H2,1-4H3,(H,20,24)(H,18,19,23)/t11-,16-/m0/s1 |
| InChIKey | FDEKPOVLLPZVPF-ZBEGNZNMSA-N |
| XLogP | 0.18 |
| TPSA | 148.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.95 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|