C25H42ClN5O6SSi2 — CID 154478352
2-trimethylsilylethyl 2-[[2-[[1-[tert-butyl(dimethyl)silyl]-2-oxoazetidin-3-yl]amino]-1-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-oxoethylidene]amino]oxy-2-methylpropanoate (PubChem CID 154478352) has the molecular formula C25H42ClN5O6SSi2 and a molecular weight of 632.33 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2-[[2-[[1-[tert-butyl(dimethyl)silyl]-2-oxoazetidin-3-yl]amino]-1-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-oxoethylidene]amino]oxy-2-methylpropanoate.
| Compound Name | 2-trimethylsilylethyl 2-[[2-[[1-[tert-butyl(dimethyl)silyl]-2-oxoazetidin-3-yl]amino]-1-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-oxoethylidene]amino]oxy-2-methylpropanoate |
|---|---|
| PubChem CID | 154478352 |
| Molecular Formula | C25H42ClN5O6SSi2 |
| Molecular Weight | 632.33 g/mol |
| Exact Mass | 631.21 |
| IUPAC Name | 2-trimethylsilylethyl 2-[[2-[[1-[tert-butyl(dimethyl)silyl]-2-oxoazetidin-3-yl]amino]-1-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-oxoethylidene]amino]oxy-2-methylpropanoate |
| SMILES | CC(C)(ON=C(C(=O)NC1CN([Si](C)(C)C(C)(C)C)C1=O)c1csc(NC(=O)CCl)n1)C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C25H42ClN5O6SSi2/c1-24(2,3)40(9,10)31-14-16(21(31)34)27-20(33)19(17-15-38-23(28-17)29-18(32)13-26)30-37-25(4,5)22(35)36-11-12-39(6,7)8/h15-16H,11-14H2,1-10H3,(H,27,33)(H,28,29,32) |
| InChIKey | OUQAMOGBUKPAMJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 139.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.33 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|