C16H24ClN3O5SSi — CID 22839744
2-trimethylsilylethyl 2-[(E)-[1-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-oxoethylidene]amino]oxy-2-methylpropanoate (PubChem CID 22839744) has the molecular formula C16H24ClN3O5SSi and a molecular weight of 433.99 g/mol. Its IUPAC name is 2-trimethylsilylethyl 2-[(E)-[1-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-oxoethylidene]amino]oxy-2-methylpropanoate.
| Compound Name | 2-trimethylsilylethyl 2-[(E)-[1-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-oxoethylidene]amino]oxy-2-methylpropanoate |
|---|---|
| PubChem CID | 22839744 |
| Molecular Formula | C16H24ClN3O5SSi |
| Molecular Weight | 433.99 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | 2-trimethylsilylethyl 2-[(E)-[1-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-oxoethylidene]amino]oxy-2-methylpropanoate |
| SMILES | CC(C)(O/N=C(/C=O)c1csc(NC(=O)CCl)n1)C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C16H24ClN3O5SSi/c1-16(2,14(23)24-6-7-27(3,4)5)25-20-11(9-21)12-10-26-15(18-12)19-13(22)8-17/h9-10H,6-8H2,1-5H3,(H,18,19,22)/b20-11- |
| InChIKey | CJFMCPMUSJRZQP-JAIQZWGSSA-N |
| XLogP | 2.90 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.99 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|