C17H15N5O10S2 — CID 142395154
4-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(1-carboxyethenoxyimino)acetyl]amino]-3,6,10-trioxo-11-oxa-6λ4-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid (PubChem CID 142395154) has the molecular formula C17H15N5O10S2 and a molecular weight of 513.47 g/mol. Its IUPAC name is 4-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(1-carboxyethenoxyimino)acetyl]amino]-3,6,10-trioxo-11-oxa-6λ4-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid.
| Compound Name | 4-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(1-carboxyethenoxyimino)acetyl]amino]-3,6,10-trioxo-11-oxa-6λ4-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid |
|---|---|
| PubChem CID | 142395154 |
| Molecular Formula | C17H15N5O10S2 |
| Molecular Weight | 513.47 g/mol |
| Exact Mass | 513.03 |
| IUPAC Name | 4-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(1-carboxyethenoxyimino)acetyl]amino]-3,6,10-trioxo-11-oxa-6λ4-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid |
| SMILES | C=C(O/N=C(\C(=O)NC1C(=O)N2C1S(=O)CC1CC(=O)OC12C(=O)O)c1csc(N)n1)C(=O)O |
| InChI | InChI=1S/C17H15N5O10S2/c1-5(14(26)27)32-21-9(7-3-33-16(18)19-7)11(24)20-10-12(25)22-13(10)34(30)4-6-2-8(23)31-17(6,22)15(28)29/h3,6,10,13H,1-2,4H2,(H2,18,19)(H,20,24)(H,26,27)(H,28,29)/b21-9- |
| InChIKey | WOTUPAIJGDVRAO-NKVSQWTQSA-N |
| XLogP | -2.20 |
| TPSA | 227.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.47 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|