C20H18N6O8S2 — CID 135196912
(1R,4R,5R,6S,8R)-4-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(pyridin-3-ylmethoxyimino)acetyl]amino]-3,6,10-trioxo-11-oxa-6λ4-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid (PubChem CID 135196912) has the molecular formula C20H18N6O8S2 and a molecular weight of 534.53 g/mol. Its IUPAC name is (1R,4R,5R,6S,8R)-4-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(pyridin-3-ylmethoxyimino)acetyl]amino]-3,6,10-trioxo-11-oxa-6λ4-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid.
| Compound Name | (1R,4R,5R,6S,8R)-4-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(pyridin-3-ylmethoxyimino)acetyl]amino]-3,6,10-trioxo-11-oxa-6λ4-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid |
|---|---|
| PubChem CID | 135196912 |
| Molecular Formula | C20H18N6O8S2 |
| Molecular Weight | 534.53 g/mol |
| Exact Mass | 534.06 |
| IUPAC Name | (1R,4R,5R,6S,8R)-4-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-(pyridin-3-ylmethoxyimino)acetyl]amino]-3,6,10-trioxo-11-oxa-6λ4-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid |
| SMILES | Nc1nc(/C(=N/OCc2cccnc2)C(=O)N[C@@H]2C(=O)N3[C@@H]2[S@@](=O)C[C@@H]2CC(=O)O[C@@]23C(=O)O)cs1 |
| InChI | InChI=1S/C20H18N6O8S2/c21-19-23-11(7-35-19)13(25-33-6-9-2-1-3-22-5-9)15(28)24-14-16(29)26-17(14)36(32)8-10-4-12(27)34-20(10,26)18(30)31/h1-3,5,7,10,14,17H,4,6,8H2,(H2,21,23)(H,24,28)(H,30,31)/b25-13-/t10-,14+,17+,20+,36-/m0/s1 |
| InChIKey | TVPPQTJUQLGOPK-JEUNQBLHSA-N |
| XLogP | -1.20 |
| TPSA | 203.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.53 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|