C17H16N4O10S2 — CID 172942094
(1R,4R,5R,6R,8R)-4-[(3Z)-3-(2-amino-1,3-thiazol-4-yl)-3-(carboxymethoxyimino)-2-oxopropyl]-3,6,10-trioxo-11-oxa-6λ4-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid (PubChem CID 172942094) has the molecular formula C17H16N4O10S2 and a molecular weight of 500.47 g/mol. Its IUPAC name is (1R,4R,5R,6R,8R)-4-[(3Z)-3-(2-amino-1,3-thiazol-4-yl)-3-(carboxymethoxyimino)-2-oxopropyl]-3,6,10-trioxo-11-oxa-6λ4-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid.
| Compound Name | (1R,4R,5R,6R,8R)-4-[(3Z)-3-(2-amino-1,3-thiazol-4-yl)-3-(carboxymethoxyimino)-2-oxopropyl]-3,6,10-trioxo-11-oxa-6λ4-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid |
|---|---|
| PubChem CID | 172942094 |
| Molecular Formula | C17H16N4O10S2 |
| Molecular Weight | 500.47 g/mol |
| Exact Mass | 500.03 |
| IUPAC Name | (1R,4R,5R,6R,8R)-4-[(3Z)-3-(2-amino-1,3-thiazol-4-yl)-3-(carboxymethoxyimino)-2-oxopropyl]-3,6,10-trioxo-11-oxa-6λ4-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid |
| SMILES | Nc1nc(/C(=N/OCC(=O)O)C(=O)C[C@@H]2C(=O)N3[C@@H]2[S@](=O)C[C@@H]2CC(=O)O[C@@]23C(=O)O)cs1 |
| InChI | InChI=1S/C17H16N4O10S2/c18-16-19-8(4-32-16)12(20-30-3-10(23)24)9(22)2-7-13(26)21-14(7)33(29)5-6-1-11(25)31-17(6,21)15(27)28/h4,6-7,14H,1-3,5H2,(H2,18,19)(H,23,24)(H,27,28)/b20-12-/t6-,7+,14+,17+,33+/m0/s1 |
| InChIKey | HATHJWPEXXKVEK-DBHQWWRPSA-N |
| XLogP | -1.62 |
| TPSA | 215.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.47 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|