C17H18N6O9S2 — CID 142395145
4-[[(2Z)-2-(2-amino-2-oxoethoxy)imino-2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-9-methyl-3,6,10-trioxo-11-oxa-6λ4-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid (PubChem CID 142395145) has the molecular formula C17H18N6O9S2 and a molecular weight of 514.50 g/mol. Its IUPAC name is 4-[[(2Z)-2-(2-amino-2-oxoethoxy)imino-2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-9-methyl-3,6,10-trioxo-11-oxa-6λ4-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid.
| Compound Name | 4-[[(2Z)-2-(2-amino-2-oxoethoxy)imino-2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-9-methyl-3,6,10-trioxo-11-oxa-6λ4-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid |
|---|---|
| PubChem CID | 142395145 |
| Molecular Formula | C17H18N6O9S2 |
| Molecular Weight | 514.50 g/mol |
| Exact Mass | 514.06 |
| IUPAC Name | 4-[[(2Z)-2-(2-amino-2-oxoethoxy)imino-2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-9-methyl-3,6,10-trioxo-11-oxa-6λ4-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid |
| SMILES | CC1C(=O)OC2(C(=O)O)C1CS(=O)C1C(NC(=O)/C(=N\OCC(N)=O)c3csc(N)n3)C(=O)N12 |
| InChI | InChI=1S/C17H18N6O9S2/c1-5-6-4-34(30)13-10(12(26)23(13)17(6,15(28)29)32-14(5)27)21-11(25)9(22-31-2-8(18)24)7-3-33-16(19)20-7/h3,5-6,10,13H,2,4H2,1H3,(H2,18,24)(H2,19,20)(H,21,25)(H,28,29)/b22-9- |
| InChIKey | HMSCWFLGSWFYRT-AFPJDJCSSA-N |
| XLogP | -3.06 |
| TPSA | 233.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.50 |
| LogP ≤ 5 | -3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|