C15H14N5NaO7S2 — CID 23700634
sodium (1R,4S,5S,8R)-4-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3,10-dioxo-11-oxa-7-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylate (PubChem CID 23700634) has the molecular formula C15H14N5NaO7S2 and a molecular weight of 463.43 g/mol. Its IUPAC name is sodium (1R,4S,5S,8R)-4-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3,10-dioxo-11-oxa-7-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylate.
| Compound Name | sodium (1R,4S,5S,8R)-4-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3,10-dioxo-11-oxa-7-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylate |
|---|---|
| PubChem CID | 23700634 |
| Molecular Formula | C15H14N5NaO7S2 |
| Molecular Weight | 463.43 g/mol |
| Exact Mass | 463.02 |
| IUPAC Name | sodium (1R,4S,5S,8R)-4-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3,10-dioxo-11-oxa-7-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylate |
| SMILES | CO/N=C(\C(=O)N[C@@H]1C(=O)N2[C@@H]1CS[C@@H]1CC(=O)O[C@]12C(=O)[O-])c1csc(N)n1.[Na+] |
| InChI | InChI=1S/C15H15N5O7S2.Na/c1-26-19-9(5-3-29-14(16)17-5)11(22)18-10-6-4-28-7-2-8(21)27-15(7,13(24)25)20(6)12(10)23;/h3,6-7,10H,2,4H2,1H3,(H2,16,17)(H,18,22)(H,24,25);/q;+1/p-1/b19-9-;/t6-,7-,10+,15+;/m1./s1 |
| InChIKey | PVQZAJKKTYHWEX-DSCQEKQFSA-M |
| XLogP | -5.72 |
| TPSA | 176.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.43 |
| LogP ≤ 5 | -5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|