C16H14ClN5O8S2 — CID 57075954
(1R,4R,5R,7S)-4-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-3,9-dioxo-10-oxa-6-thia-2-azatricyclo[5.3.0.02,5]decane-1-carboxylic acid (PubChem CID 57075954) has the molecular formula C16H14ClN5O8S2 and a molecular weight of 503.90 g/mol. Its IUPAC name is (1R,4R,5R,7S)-4-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-3,9-dioxo-10-oxa-6-thia-2-azatricyclo[5.3.0.02,5]decane-1-carboxylic acid.
| Compound Name | (1R,4R,5R,7S)-4-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-3,9-dioxo-10-oxa-6-thia-2-azatricyclo[5.3.0.02,5]decane-1-carboxylic acid |
|---|---|
| PubChem CID | 57075954 |
| Molecular Formula | C16H14ClN5O8S2 |
| Molecular Weight | 503.90 g/mol |
| Exact Mass | 503.00 |
| IUPAC Name | (1R,4R,5R,7S)-4-[[2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-2-methoxyiminoacetyl]amino]-3,9-dioxo-10-oxa-6-thia-2-azatricyclo[5.3.0.02,5]decane-1-carboxylic acid |
| SMILES | CON=C(C(=O)N[C@@H]1C(=O)N2[C@@H]1S[C@H]1CC(=O)O[C@]12C(=O)O)c1csc(NC(=O)CCl)n1 |
| InChI | InChI=1S/C16H14ClN5O8S2/c1-29-21-9(5-4-31-15(18-5)19-7(23)3-17)11(25)20-10-12(26)22-13(10)32-6-2-8(24)30-16(6,22)14(27)28/h4,6,10,13H,2-3H2,1H3,(H,20,25)(H,27,28)(H,18,19,23)/t6-,10+,13+,16-/m0/s1 |
| InChIKey | JQMYZFDVJOUZEA-YIXVYASFSA-N |
| XLogP | -0.83 |
| TPSA | 176.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.90 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|