C18H19N5O11S2 — CID 134485690
(1R,4R,5R,8R)-4-[[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[(1R)-1-carboxyethoxy]iminoacetyl]amino]methyl]-3,6,6,10-tetraoxo-11-oxa-6λ6-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid (PubChem CID 134485690) has the molecular formula C18H19N5O11S2 and a molecular weight of 545.51 g/mol. Its IUPAC name is (1R,4R,5R,8R)-4-[[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[(1R)-1-carboxyethoxy]iminoacetyl]amino]methyl]-3,6,6,10-tetraoxo-11-oxa-6λ6-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid.
| Compound Name | (1R,4R,5R,8R)-4-[[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[(1R)-1-carboxyethoxy]iminoacetyl]amino]methyl]-3,6,6,10-tetraoxo-11-oxa-6λ6-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid |
|---|---|
| PubChem CID | 134485690 |
| Molecular Formula | C18H19N5O11S2 |
| Molecular Weight | 545.51 g/mol |
| Exact Mass | 545.05 |
| IUPAC Name | (1R,4R,5R,8R)-4-[[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[(1R)-1-carboxyethoxy]iminoacetyl]amino]methyl]-3,6,6,10-tetraoxo-11-oxa-6λ6-thia-2-azatricyclo[6.3.0.02,5]undecane-1-carboxylic acid |
| SMILES | C[C@@H](O/N=C(\C(=O)NC[C@@H]1C(=O)N2[C@@H]1S(=O)(=O)C[C@@H]1CC(=O)O[C@@]12C(=O)O)c1csc(N)n1)C(=O)O |
| InChI | InChI=1S/C18H19N5O11S2/c1-6(15(27)28)34-22-11(9-4-35-17(19)21-9)12(25)20-3-8-13(26)23-14(8)36(31,32)5-7-2-10(24)33-18(7,23)16(29)30/h4,6-8,14H,2-3,5H2,1H3,(H2,19,21)(H,20,25)(H,27,28)(H,29,30)/b22-11-/t6-,7+,8-,14-,18-/m1/s1 |
| InChIKey | ZIEFFNMHJNCMKX-GZVDADRKSA-N |
| XLogP | -2.41 |
| TPSA | 244.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.51 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|