C16H17N5O5S2 — CID 173428981
(6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-prop-2-enoxyiminoacetyl]amino]-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-3-carboxylic acid (PubChem CID 173428981) has the molecular formula C16H17N5O5S2 and a molecular weight of 423.48 g/mol. Its IUPAC name is (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-prop-2-enoxyiminoacetyl]amino]-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-3-carboxylic acid.
| Compound Name | (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-prop-2-enoxyiminoacetyl]amino]-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-3-carboxylic acid |
|---|---|
| PubChem CID | 173428981 |
| Molecular Formula | C16H17N5O5S2 |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | (6R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-prop-2-enoxyiminoacetyl]amino]-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-3-carboxylic acid |
| SMILES | C=CCON=C(C(=O)NC1C(=O)N2C=C(C(=O)O)C(C)S[C@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C16H17N5O5S2/c1-3-4-26-20-10(9-6-27-16(17)18-9)12(22)19-11-13(23)21-5-8(15(24)25)7(2)28-14(11)21/h3,5-7,11,14H,1,4H2,2H3,(H2,17,18)(H,19,22)(H,24,25)/t7?,11?,14-/m1/s1 |
| InChIKey | UMUOWOONNLVTBP-FIKRSJQMSA-N |
| XLogP | 0.39 |
| TPSA | 147.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|