C18H17N5O5S — CID 173411169
(6R)-7-[[2-(6-amino-2-pyridinyl)-2-prop-2-ynoxyiminoacetyl]amino]-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-3-carboxylic acid (PubChem CID 173411169) has the molecular formula C18H17N5O5S and a molecular weight of 415.43 g/mol. Its IUPAC name is (6R)-7-[[2-(6-amino-2-pyridinyl)-2-prop-2-ynoxyiminoacetyl]amino]-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-3-carboxylic acid.
| Compound Name | (6R)-7-[[2-(6-amino-2-pyridinyl)-2-prop-2-ynoxyiminoacetyl]amino]-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-3-carboxylic acid |
|---|---|
| PubChem CID | 173411169 |
| Molecular Formula | C18H17N5O5S |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | (6R)-7-[[2-(6-amino-2-pyridinyl)-2-prop-2-ynoxyiminoacetyl]amino]-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-3-carboxylic acid |
| SMILES | C#CCON=C(C(=O)NC1C(=O)N2C=C(C(=O)O)C(C)S[C@H]12)c1cccc(N)n1 |
| InChI | InChI=1S/C18H17N5O5S/c1-3-7-28-22-13(11-5-4-6-12(19)20-11)15(24)21-14-16(25)23-8-10(18(26)27)9(2)29-17(14)23/h1,4-6,8-9,14,17H,7H2,2H3,(H2,19,20)(H,21,24)(H,26,27)/t9?,14?,17-/m1/s1 |
| InChIKey | RGQIRGVJCOASKJ-BQZDTTFQSA-N |
| XLogP | -0.23 |
| TPSA | 147.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|