C18H19N5O5S — CID 88675276
(6R)-7-[[(2Z)-2-(6-amino-2-pyridinyl)-2-prop-2-enoxyiminoacetyl]amino]-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88675276) has the molecular formula C18H19N5O5S and a molecular weight of 417.45 g/mol. Its IUPAC name is (6R)-7-[[(2Z)-2-(6-amino-2-pyridinyl)-2-prop-2-enoxyiminoacetyl]amino]-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-7-[[(2Z)-2-(6-amino-2-pyridinyl)-2-prop-2-enoxyiminoacetyl]amino]-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88675276 |
| Molecular Formula | C18H19N5O5S |
| Molecular Weight | 417.45 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | (6R)-7-[[(2Z)-2-(6-amino-2-pyridinyl)-2-prop-2-enoxyiminoacetyl]amino]-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | C=CCO/N=C(\C(=O)NC1C(=O)N2C(C(=O)O)=CC(C)S[C@H]12)c1cccc(N)n1 |
| InChI | InChI=1S/C18H19N5O5S/c1-3-7-28-22-13(10-5-4-6-12(19)20-10)15(24)21-14-16(25)23-11(18(26)27)8-9(2)29-17(14)23/h3-6,8-9,14,17H,1,7H2,2H3,(H2,19,20)(H,21,24)(H,26,27)/b22-13-/t9?,14?,17-/m1/s1 |
| InChIKey | GSMZTKGFPIRUHJ-DSSHTBPWSA-N |
| XLogP | 0.33 |
| TPSA | 147.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.45 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|