C17H19N5O5S — CID 154416384
(6R)-7-[[2-(6-amino-2-pyridinyl)-2-ethoxyiminoacetyl]amino]-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 154416384) has the molecular formula C17H19N5O5S and a molecular weight of 405.44 g/mol. Its IUPAC name is (6R)-7-[[2-(6-amino-2-pyridinyl)-2-ethoxyiminoacetyl]amino]-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-7-[[2-(6-amino-2-pyridinyl)-2-ethoxyiminoacetyl]amino]-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 154416384 |
| Molecular Formula | C17H19N5O5S |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | (6R)-7-[[2-(6-amino-2-pyridinyl)-2-ethoxyiminoacetyl]amino]-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CCON=C(C(=O)NC1C(=O)N2C(C(=O)O)=CC(C)S[C@H]12)c1cccc(N)n1 |
| InChI | InChI=1S/C17H19N5O5S/c1-3-27-21-12(9-5-4-6-11(18)19-9)14(23)20-13-15(24)22-10(17(25)26)7-8(2)28-16(13)22/h4-8,13,16H,3H2,1-2H3,(H2,18,19)(H,20,23)(H,25,26)/t8?,13?,16-/m1/s1 |
| InChIKey | XIVCXMNAYQXZAQ-FODUMWHGSA-N |
| XLogP | 0.16 |
| TPSA | 147.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|