C22H19N5O6S — CID 88675257
(6R)-7-[[(2E)-2-(6-formamido-2-pyridinyl)-2-phenoxyiminoacetyl]amino]-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88675257) has the molecular formula C22H19N5O6S and a molecular weight of 481.49 g/mol. Its IUPAC name is (6R)-7-[[(2E)-2-(6-formamido-2-pyridinyl)-2-phenoxyiminoacetyl]amino]-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-7-[[(2E)-2-(6-formamido-2-pyridinyl)-2-phenoxyiminoacetyl]amino]-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88675257 |
| Molecular Formula | C22H19N5O6S |
| Molecular Weight | 481.49 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | (6R)-7-[[(2E)-2-(6-formamido-2-pyridinyl)-2-phenoxyiminoacetyl]amino]-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CC1C=C(C(=O)O)N2C(=O)C(NC(=O)/C(=N/Oc3ccccc3)c3cccc(NC=O)n3)[C@H]2S1 |
| InChI | InChI=1S/C22H19N5O6S/c1-12-10-15(22(31)32)27-20(30)18(21(27)34-12)25-19(29)17(26-33-13-6-3-2-4-7-13)14-8-5-9-16(24-14)23-11-28/h2-12,18,21H,1H3,(H,25,29)(H,31,32)(H,23,24,28)/b26-17+/t12?,18?,21-/m1/s1 |
| InChIKey | FQCUACGADJJBMS-OZMXOVRQSA-N |
| XLogP | 1.19 |
| TPSA | 150.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.49 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|