C16H16N2O3S2 — CID 54499171
(6S)-4-methyl-8-oxo-7-[(2-phenylethanethioyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 54499171) has the molecular formula C16H16N2O3S2 and a molecular weight of 348.45 g/mol. Its IUPAC name is (6S)-4-methyl-8-oxo-7-[(2-phenylethanethioyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S)-4-methyl-8-oxo-7-[(2-phenylethanethioyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 54499171 |
| Molecular Formula | C16H16N2O3S2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | (6S)-4-methyl-8-oxo-7-[(2-phenylethanethioyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CC1C=C(C(=O)O)N2C(=O)C(NC(=S)Cc3ccccc3)[C@@H]2S1 |
| InChI | InChI=1S/C16H16N2O3S2/c1-9-7-11(16(20)21)18-14(19)13(15(18)23-9)17-12(22)8-10-5-3-2-4-6-10/h2-7,9,13,15H,8H2,1H3,(H,17,22)(H,20,21)/t9?,13?,15-/m0/s1 |
| InChIKey | YBFSLVNVCUDZDT-MVHHZSLRSA-N |
| XLogP | 1.79 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|