C14H13N3O3S2 — CID 88644021
(6R,7R)-8-oxo-7-[(2-pyridin-4-ylethanethioyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88644021) has the molecular formula C14H13N3O3S2 and a molecular weight of 335.41 g/mol. Its IUPAC name is (6R,7R)-8-oxo-7-[(2-pyridin-4-ylethanethioyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7R)-8-oxo-7-[(2-pyridin-4-ylethanethioyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88644021 |
| Molecular Formula | C14H13N3O3S2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | (6R,7R)-8-oxo-7-[(2-pyridin-4-ylethanethioyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | O=C(O)C1=CCS[C@@H]2[C@H](NC(=S)Cc3ccncc3)C(=O)N12 |
| InChI | InChI=1S/C14H13N3O3S2/c18-12-11(13-17(12)9(14(19)20)3-6-22-13)16-10(21)7-8-1-4-15-5-2-8/h1-5,11,13H,6-7H2,(H,16,21)(H,19,20)/t11-,13-/m1/s1 |
| InChIKey | VHFUBPLTHXSNKE-DGCLKSJQSA-N |
| XLogP | 0.79 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|