C20H22N2O7S — CID 70556369
2-ethoxycarbonyloxyethyl (6S)-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 70556369) has the molecular formula C20H22N2O7S and a molecular weight of 434.47 g/mol. Its IUPAC name is 2-ethoxycarbonyloxyethyl (6S)-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | 2-ethoxycarbonyloxyethyl (6S)-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 70556369 |
| Molecular Formula | C20H22N2O7S |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 2-ethoxycarbonyloxyethyl (6S)-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CCOC(=O)OCCOC(=O)C1=CCS[C@H]2C(NC(=O)Cc3ccccc3)C(=O)N12 |
| InChI | InChI=1S/C20H22N2O7S/c1-2-27-20(26)29-10-9-28-19(25)14-8-11-30-18-16(17(24)22(14)18)21-15(23)12-13-6-4-3-5-7-13/h3-8,16,18H,2,9-12H2,1H3,(H,21,23)/t16?,18-/m0/s1 |
| InChIKey | UVBPQXDPHMUEMU-DAFXYXGESA-N |
| XLogP | 1.23 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|