C18H18N2O8S — CID 70437999
acetyloxymethyl (6R)-7-[[2-(2,5-dihydroxyphenyl)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 70437999) has the molecular formula C18H18N2O8S and a molecular weight of 422.42 g/mol. Its IUPAC name is acetyloxymethyl (6R)-7-[[2-(2,5-dihydroxyphenyl)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | acetyloxymethyl (6R)-7-[[2-(2,5-dihydroxyphenyl)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 70437999 |
| Molecular Formula | C18H18N2O8S |
| Molecular Weight | 422.42 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | acetyloxymethyl (6R)-7-[[2-(2,5-dihydroxyphenyl)acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC(=O)OCOC(=O)C1=CCS[C@@H]2C(NC(=O)Cc3cc(O)ccc3O)C(=O)N12 |
| InChI | InChI=1S/C18H18N2O8S/c1-9(21)27-8-28-18(26)12-4-5-29-17-15(16(25)20(12)17)19-14(24)7-10-6-11(22)2-3-13(10)23/h2-4,6,15,17,22-23H,5,7-8H2,1H3,(H,19,24)/t15?,17-/m1/s1 |
| InChIKey | ONDSRYQOKACQDX-OMOCHNIRSA-N |
| XLogP | -0.01 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.42 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|