C26H27N3O10S — CID 139725822
2-ethoxycarbonyloxyethyl (6R)-3-(carbamoyloxymethyl)-7-(naphthalen-2-ylmethoxycarbonylamino)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 139725822) has the molecular formula C26H27N3O10S and a molecular weight of 573.58 g/mol. Its IUPAC name is 2-ethoxycarbonyloxyethyl (6R)-3-(carbamoyloxymethyl)-7-(naphthalen-2-ylmethoxycarbonylamino)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | 2-ethoxycarbonyloxyethyl (6R)-3-(carbamoyloxymethyl)-7-(naphthalen-2-ylmethoxycarbonylamino)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 139725822 |
| Molecular Formula | C26H27N3O10S |
| Molecular Weight | 573.58 g/mol |
| Exact Mass | 573.14 |
| IUPAC Name | 2-ethoxycarbonyloxyethyl (6R)-3-(carbamoyloxymethyl)-7-(naphthalen-2-ylmethoxycarbonylamino)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CCOC(=O)OCCOC(=O)C1=C(COC(N)=O)CS[C@@H]2C(NC(=O)OCc3ccc4ccccc4c3)C(=O)N12 |
| InChI | InChI=1S/C26H27N3O10S/c1-2-35-26(34)37-10-9-36-23(31)20-18(13-38-24(27)32)14-40-22-19(21(30)29(20)22)28-25(33)39-12-15-7-8-16-5-3-4-6-17(16)11-15/h3-8,11,19,22H,2,9-10,12-14H2,1H3,(H2,27,32)(H,28,33)/t19?,22-/m1/s1 |
| InChIKey | DVWDFZXQEKADSV-AVKWCDSFSA-N |
| XLogP | 2.42 |
| TPSA | 172.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.58 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|