C19H20N4O7S — CID 88794796
(6R,7R)-3-(carbamoyloxymethyl)-7-[[(2Z)-2-ethoxyimino-2-phenylacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88794796) has the molecular formula C19H20N4O7S and a molecular weight of 448.46 g/mol. Its IUPAC name is (6R,7R)-3-(carbamoyloxymethyl)-7-[[(2Z)-2-ethoxyimino-2-phenylacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7R)-3-(carbamoyloxymethyl)-7-[[(2Z)-2-ethoxyimino-2-phenylacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88794796 |
| Molecular Formula | C19H20N4O7S |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | (6R,7R)-3-(carbamoyloxymethyl)-7-[[(2Z)-2-ethoxyimino-2-phenylacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CCO/N=C(\C(=O)N[C@@H]1C(=O)N2C(C(=O)O)=C(COC(N)=O)CS[C@H]12)c1ccccc1 |
| InChI | InChI=1S/C19H20N4O7S/c1-2-30-22-12(10-6-4-3-5-7-10)15(24)21-13-16(25)23-14(18(26)27)11(8-29-19(20)28)9-31-17(13)23/h3-7,13,17H,2,8-9H2,1H3,(H2,20,28)(H,21,24)(H,26,27)/b22-12-/t13-,17-/m1/s1 |
| InChIKey | IHTIDABULNQFAD-PJVNKMEESA-N |
| XLogP | 0.26 |
| TPSA | 160.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|