C19H19N3O7S2 — CID 88644515
(6R)-7-[[(2E)-2-(carboxymethoxyimino)-2-phenylacetyl]amino]-3-ethylsulfanyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88644515) has the molecular formula C19H19N3O7S2 and a molecular weight of 465.51 g/mol. Its IUPAC name is (6R)-7-[[(2E)-2-(carboxymethoxyimino)-2-phenylacetyl]amino]-3-ethylsulfanyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-7-[[(2E)-2-(carboxymethoxyimino)-2-phenylacetyl]amino]-3-ethylsulfanyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88644515 |
| Molecular Formula | C19H19N3O7S2 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | (6R)-7-[[(2E)-2-(carboxymethoxyimino)-2-phenylacetyl]amino]-3-ethylsulfanyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CCSC1=C(C(=O)O)N2C(=O)C(NC(=O)/C(=N/OCC(=O)O)c3ccccc3)[C@H]2SC1 |
| InChI | InChI=1S/C19H19N3O7S2/c1-2-30-11-9-31-18-14(17(26)22(18)15(11)19(27)28)20-16(25)13(21-29-8-12(23)24)10-6-4-3-5-7-10/h3-7,14,18H,2,8-9H2,1H3,(H,20,25)(H,23,24)(H,27,28)/b21-13+/t14?,18-/m1/s1 |
| InChIKey | IADATVACCKOQJR-CQWARVPCSA-N |
| XLogP | 0.94 |
| TPSA | 145.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|