C13H15Cl3N2O3S2 — CID 131711257
2,2,2-trichloroethyl (6R)-4-methyl-8-oxo-7-(propanethioylamino)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 131711257) has the molecular formula C13H15Cl3N2O3S2 and a molecular weight of 417.77 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (6R)-4-methyl-8-oxo-7-(propanethioylamino)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | 2,2,2-trichloroethyl (6R)-4-methyl-8-oxo-7-(propanethioylamino)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 131711257 |
| Molecular Formula | C13H15Cl3N2O3S2 |
| Molecular Weight | 417.77 g/mol |
| Exact Mass | 415.96 |
| IUPAC Name | 2,2,2-trichloroethyl (6R)-4-methyl-8-oxo-7-(propanethioylamino)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CCC(=S)NC1C(=O)N2C(C(=O)OCC(Cl)(Cl)Cl)=CC(C)S[C@H]12 |
| InChI | InChI=1S/C13H15Cl3N2O3S2/c1-3-8(22)17-9-10(19)18-7(4-6(2)23-11(9)18)12(20)21-5-13(14,15)16/h4,6,9,11H,3,5H2,1-2H3,(H,17,22)/t6?,9?,11-/m1/s1 |
| InChIKey | MLIQOSONXNDEJW-PPACVUAOSA-N |
| XLogP | 2.78 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.77 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|