C28H25Cl3N2O6S — CID 54555336
2,2,2-trichloroethyl (6S)-7-[[3-(2,3-dihydro-1H-inden-5-yloxy)-3-oxo-2-phenylpropanoyl]amino]-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 54555336) has the molecular formula C28H25Cl3N2O6S and a molecular weight of 623.94 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (6S)-7-[[3-(2,3-dihydro-1H-inden-5-yloxy)-3-oxo-2-phenylpropanoyl]amino]-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | 2,2,2-trichloroethyl (6S)-7-[[3-(2,3-dihydro-1H-inden-5-yloxy)-3-oxo-2-phenylpropanoyl]amino]-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 54555336 |
| Molecular Formula | C28H25Cl3N2O6S |
| Molecular Weight | 623.94 g/mol |
| Exact Mass | 622.05 |
| IUPAC Name | 2,2,2-trichloroethyl (6S)-7-[[3-(2,3-dihydro-1H-inden-5-yloxy)-3-oxo-2-phenylpropanoyl]amino]-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC1C=C(C(=O)OCC(Cl)(Cl)Cl)N2C(=O)C(NC(=O)C(C(=O)Oc3ccc4c(c3)CCC4)c3ccccc3)[C@@H]2S1 |
| InChI | InChI=1S/C28H25Cl3N2O6S/c1-15-12-20(26(36)38-14-28(29,30)31)33-24(35)22(25(33)40-15)32-23(34)21(17-6-3-2-4-7-17)27(37)39-19-11-10-16-8-5-9-18(16)13-19/h2-4,6-7,10-13,15,21-22,25H,5,8-9,14H2,1H3,(H,32,34)/t15?,21?,22?,25-/m0/s1 |
| InChIKey | ZMTXKSHNMRADOW-XRFKCNDXSA-N |
| XLogP | 4.45 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.94 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|