C29H27N5O8S — CID 22767767
3-(acetyloxymethyl)-7-[[2-[4-(azidomethyl)phenyl]-3-(2,3-dihydro-1H-inden-5-yloxy)-3-oxopropanoyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 22767767) has the molecular formula C29H27N5O8S and a molecular weight of 605.63 g/mol. Its IUPAC name is 3-(acetyloxymethyl)-7-[[2-[4-(azidomethyl)phenyl]-3-(2,3-dihydro-1H-inden-5-yloxy)-3-oxopropanoyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | 3-(acetyloxymethyl)-7-[[2-[4-(azidomethyl)phenyl]-3-(2,3-dihydro-1H-inden-5-yloxy)-3-oxopropanoyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 22767767 |
| Molecular Formula | C29H27N5O8S |
| Molecular Weight | 605.63 g/mol |
| Exact Mass | 605.16 |
| IUPAC Name | 3-(acetyloxymethyl)-7-[[2-[4-(azidomethyl)phenyl]-3-(2,3-dihydro-1H-inden-5-yloxy)-3-oxopropanoyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CC(=O)OCC1=C(C(=O)O)N2C(=O)C(NC(=O)C(C(=O)Oc3ccc4c(c3)CCC4)c3ccc(CN=[N+]=[N-])cc3)C2SC1 |
| InChI | InChI=1S/C29H27N5O8S/c1-15(35)41-13-20-14-43-27-23(26(37)34(27)24(20)28(38)39)32-25(36)22(18-7-5-16(6-8-18)12-31-33-30)29(40)42-21-10-9-17-3-2-4-19(17)11-21/h5-11,22-23,27H,2-4,12-14H2,1H3,(H,32,36)(H,38,39) |
| InChIKey | YNBVUAOFFGARAU-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 188.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.63 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|