C24H25ClN2O10S — CID 54166567
3-[[3-(acetyloxymethyl)-8-oxo-2-(propanoyloxymethoxycarbonyl)-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]amino]-2-[4-(chloromethyl)phenyl]-3-oxopropanoic acid (PubChem CID 54166567) has the molecular formula C24H25ClN2O10S and a molecular weight of 568.99 g/mol. Its IUPAC name is 3-[[3-(acetyloxymethyl)-8-oxo-2-(propanoyloxymethoxycarbonyl)-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]amino]-2-[4-(chloromethyl)phenyl]-3-oxopropanoic acid.
| Compound Name | 3-[[3-(acetyloxymethyl)-8-oxo-2-(propanoyloxymethoxycarbonyl)-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]amino]-2-[4-(chloromethyl)phenyl]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 54166567 |
| Molecular Formula | C24H25ClN2O10S |
| Molecular Weight | 568.99 g/mol |
| Exact Mass | 568.09 |
| IUPAC Name | 3-[[3-(acetyloxymethyl)-8-oxo-2-(propanoyloxymethoxycarbonyl)-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]amino]-2-[4-(chloromethyl)phenyl]-3-oxopropanoic acid |
| SMILES | CCC(=O)OCOC(=O)C1=C(COC(C)=O)CSC2C(NC(=O)C(C(=O)O)c3ccc(CCl)cc3)C(=O)N12 |
| InChI | InChI=1S/C24H25ClN2O10S/c1-3-16(29)36-11-37-24(34)19-15(9-35-12(2)28)10-38-22-18(21(31)27(19)22)26-20(30)17(23(32)33)14-6-4-13(8-25)5-7-14/h4-7,17-18,22H,3,8-11H2,1-2H3,(H,26,30)(H,32,33) |
| InChIKey | OSAYJUQPIZOFDG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 165.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.99 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|