C19H20N6O6S — CID 22767745
3-(acetyloxymethyl)-7-[[2-amino-2-[4-(azidomethyl)phenyl]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 22767745) has the molecular formula C19H20N6O6S and a molecular weight of 460.47 g/mol. Its IUPAC name is 3-(acetyloxymethyl)-7-[[2-amino-2-[4-(azidomethyl)phenyl]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | 3-(acetyloxymethyl)-7-[[2-amino-2-[4-(azidomethyl)phenyl]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 22767745 |
| Molecular Formula | C19H20N6O6S |
| Molecular Weight | 460.47 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 3-(acetyloxymethyl)-7-[[2-amino-2-[4-(azidomethyl)phenyl]acetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CC(=O)OCC1=C(C(=O)O)N2C(=O)C(NC(=O)C(N)c3ccc(CN=[N+]=[N-])cc3)C2SC1 |
| InChI | InChI=1S/C19H20N6O6S/c1-9(26)31-7-12-8-32-18-14(17(28)25(18)15(12)19(29)30)23-16(27)13(20)11-4-2-10(3-5-11)6-22-24-21/h2-5,13-14,18H,6-8,20H2,1H3,(H,23,27)(H,29,30) |
| InChIKey | COPVQORMMRDTNG-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 187.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.47 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|