C21H23N9O6S2 — CID 88675203
(6R)-7-[[(2Z)-2-(6-formamido-2-pyridinyl)-2-propoxyiminoacetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88675203) has the molecular formula C21H23N9O6S2 and a molecular weight of 561.61 g/mol. Its IUPAC name is (6R)-7-[[(2Z)-2-(6-formamido-2-pyridinyl)-2-propoxyiminoacetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R)-7-[[(2Z)-2-(6-formamido-2-pyridinyl)-2-propoxyiminoacetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88675203 |
| Molecular Formula | C21H23N9O6S2 |
| Molecular Weight | 561.61 g/mol |
| Exact Mass | 561.12 |
| IUPAC Name | (6R)-7-[[(2Z)-2-(6-formamido-2-pyridinyl)-2-propoxyiminoacetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CCCO/N=C(\C(=O)NC1C(=O)N2C(C(=O)O)=C(CSc3nnnn3C)CS[C@H]12)c1cccc(NC=O)n1 |
| InChI | InChI=1S/C21H23N9O6S2/c1-3-7-36-26-14(12-5-4-6-13(23-12)22-10-31)17(32)24-15-18(33)30-16(20(34)35)11(8-37-19(15)30)9-38-21-25-27-28-29(21)2/h4-6,10,15,19H,3,7-9H2,1-2H3,(H,24,32)(H,34,35)(H,22,23,31)/b26-14-/t15?,19-/m1/s1 |
| InChIKey | BHGUUKRFPAEMRB-YSSMVXEBSA-N |
| XLogP | -0.17 |
| TPSA | 193.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.61 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|