C19H19N9O6S2 — CID 54209809
(6S)-7-[[2-(4-formamido-2-pyridinyl)-2-methoxyiminoacetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 54209809) has the molecular formula C19H19N9O6S2 and a molecular weight of 533.55 g/mol. Its IUPAC name is (6S)-7-[[2-(4-formamido-2-pyridinyl)-2-methoxyiminoacetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6S)-7-[[2-(4-formamido-2-pyridinyl)-2-methoxyiminoacetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 54209809 |
| Molecular Formula | C19H19N9O6S2 |
| Molecular Weight | 533.55 g/mol |
| Exact Mass | 533.09 |
| IUPAC Name | (6S)-7-[[2-(4-formamido-2-pyridinyl)-2-methoxyiminoacetyl]amino]-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CON=C(C(=O)NC1C(=O)N2C(C(=O)O)=C(CSc3nnnn3C)CS[C@@H]12)c1cc(NC=O)ccn1 |
| InChI | InChI=1S/C19H19N9O6S2/c1-27-19(23-25-26-27)36-7-9-6-35-17-13(16(31)28(17)14(9)18(32)33)22-15(30)12(24-34-2)11-5-10(21-8-29)3-4-20-11/h3-5,8,13,17H,6-7H2,1-2H3,(H,22,30)(H,32,33)(H,20,21,29)/t13?,17-/m0/s1 |
| InChIKey | PVDRKUCXZVIGAD-RUINGEJQSA-N |
| XLogP | -0.95 |
| TPSA | 193.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.55 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|