C36H37N5O7S2 — CID 131713541
tert-butyl 2-[[2-[[(6R)-2-benzhydryloxycarbothioyl-3-ethyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]amino]-1-(6-formamido-2-pyridinyl)-2-oxoethylidene]amino]oxyacetate (PubChem CID 131713541) has the molecular formula C36H37N5O7S2 and a molecular weight of 715.85 g/mol. Its IUPAC name is tert-butyl 2-[[2-[[(6R)-2-benzhydryloxycarbothioyl-3-ethyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]amino]-1-(6-formamido-2-pyridinyl)-2-oxoethylidene]amino]oxyacetate.
| Compound Name | tert-butyl 2-[[2-[[(6R)-2-benzhydryloxycarbothioyl-3-ethyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]amino]-1-(6-formamido-2-pyridinyl)-2-oxoethylidene]amino]oxyacetate |
|---|---|
| PubChem CID | 131713541 |
| Molecular Formula | C36H37N5O7S2 |
| Molecular Weight | 715.85 g/mol |
| Exact Mass | 715.21 |
| IUPAC Name | tert-butyl 2-[[2-[[(6R)-2-benzhydryloxycarbothioyl-3-ethyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]amino]-1-(6-formamido-2-pyridinyl)-2-oxoethylidene]amino]oxyacetate |
| SMILES | CCC1=C(C(=S)OC(c2ccccc2)c2ccccc2)N2C(=O)C(NC(=O)C(=NOCC(=O)OC(C)(C)C)c3cccc(NC=O)n3)[C@H]2SC1 |
| InChI | InChI=1S/C36H37N5O7S2/c1-5-22-20-50-34-29(33(45)41(34)30(22)35(49)47-31(23-13-8-6-9-14-23)24-15-10-7-11-16-24)39-32(44)28(25-17-12-18-26(38-25)37-21-42)40-46-19-27(43)48-36(2,3)4/h6-18,21,29,31,34H,5,19-20H2,1-4H3,(H,39,44)(H,37,38,42)/t29?,34-/m1/s1 |
| InChIKey | AAAWYYGPXYVNMA-VWERDZHISA-N |
| XLogP | 4.91 |
| TPSA | 148.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.85 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|