C36H37N5O8S — CID 173359384
benzhydryl (6R)-3-ethenyl-7-[[2-(6-formamido-2-pyridinyl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]iminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate (PubChem CID 173359384) has the molecular formula C36H37N5O8S and a molecular weight of 699.79 g/mol. Its IUPAC name is benzhydryl (6R)-3-ethenyl-7-[[2-(6-formamido-2-pyridinyl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]iminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate.
| Compound Name | benzhydryl (6R)-3-ethenyl-7-[[2-(6-formamido-2-pyridinyl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]iminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
|---|---|
| PubChem CID | 173359384 |
| Molecular Formula | C36H37N5O8S |
| Molecular Weight | 699.79 g/mol |
| Exact Mass | 699.24 |
| IUPAC Name | benzhydryl (6R)-3-ethenyl-7-[[2-(6-formamido-2-pyridinyl)-2-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]iminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
| SMILES | C=CC1(C(=O)OC(c2ccccc2)c2ccccc2)CS[C@@H]2C(NC(=O)C(=NOCC(=O)OC(C)(C)C)c3cccc(NC=O)n3)C(=O)N2C1 |
| InChI | InChI=1S/C36H37N5O8S/c1-5-36(34(46)48-30(23-13-8-6-9-14-23)24-15-10-7-11-16-24)20-41-32(45)29(33(41)50-21-36)39-31(44)28(25-17-12-18-26(38-25)37-22-42)40-47-19-27(43)49-35(2,3)4/h5-18,22,29-30,33H,1,19-21H2,2-4H3,(H,39,44)(H,37,38,42)/t29?,33-,36?/m1/s1 |
| InChIKey | GBOXUANXUWAMRZ-CPWGSRFHSA-N |
| XLogP | 3.62 |
| TPSA | 165.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.79 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|