C48H42IN5O5S2 — CID 173387230
benzhydryl (6R)-3-(iodomethyl)-8-oxo-7-[[2-prop-2-enoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetyl]amino]-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate (PubChem CID 173387230) has the molecular formula C48H42IN5O5S2 and a molecular weight of 959.93 g/mol. Its IUPAC name is benzhydryl (6R)-3-(iodomethyl)-8-oxo-7-[[2-prop-2-enoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetyl]amino]-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate.
| Compound Name | benzhydryl (6R)-3-(iodomethyl)-8-oxo-7-[[2-prop-2-enoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetyl]amino]-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
|---|---|
| PubChem CID | 173387230 |
| Molecular Formula | C48H42IN5O5S2 |
| Molecular Weight | 959.93 g/mol |
| Exact Mass | 959.17 |
| IUPAC Name | benzhydryl (6R)-3-(iodomethyl)-8-oxo-7-[[2-prop-2-enoxyimino-2-[2-(tritylamino)-1,3-thiazol-4-yl]acetyl]amino]-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
| SMILES | C=CCON=C(C(=O)NC1C(=O)N2CC(CI)(C(=O)OC(c3ccccc3)c3ccccc3)CS[C@H]12)c1csc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C48H42IN5O5S2/c1-2-28-58-53-39(38-29-60-46(50-38)52-48(35-22-12-5-13-23-35,36-24-14-6-15-25-36)37-26-16-7-17-27-37)42(55)51-40-43(56)54-31-47(30-49,32-61-44(40)54)45(57)59-41(33-18-8-3-9-19-33)34-20-10-4-11-21-34/h2-27,29,40-41,44H,1,28,30-32H2,(H,50,52)(H,51,55)/t40?,44-,47?/m1/s1 |
| InChIKey | DVVXOSYJCRPUDE-ZAEXGCCASA-N |
| XLogP | 8.61 |
| TPSA | 122.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 959.93 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|