C30H29BrCl3N3O7S — CID 173360103
benzhydryl (6R)-7-[[4-bromo-3-oxo-2-[2-oxo-2-(2,2,2-trichloroethoxy)ethoxy]iminobutyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate (PubChem CID 173360103) has the molecular formula C30H29BrCl3N3O7S and a molecular weight of 761.91 g/mol. Its IUPAC name is benzhydryl (6R)-7-[[4-bromo-3-oxo-2-[2-oxo-2-(2,2,2-trichloroethoxy)ethoxy]iminobutyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate.
| Compound Name | benzhydryl (6R)-7-[[4-bromo-3-oxo-2-[2-oxo-2-(2,2,2-trichloroethoxy)ethoxy]iminobutyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
|---|---|
| PubChem CID | 173360103 |
| Molecular Formula | C30H29BrCl3N3O7S |
| Molecular Weight | 761.91 g/mol |
| Exact Mass | 759.00 |
| IUPAC Name | benzhydryl (6R)-7-[[4-bromo-3-oxo-2-[2-oxo-2-(2,2,2-trichloroethoxy)ethoxy]iminobutyl]amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
| SMILES | C=CC1(C(=O)OC(c2ccccc2)c2ccccc2)CS[C@@H]2C(NCC(=NOCC(=O)OCC(Cl)(Cl)Cl)C(=O)CBr)C(=O)N2C1 |
| InChI | InChI=1S/C30H29BrCl3N3O7S/c1-2-29(28(41)44-25(19-9-5-3-6-10-19)20-11-7-4-8-12-20)16-37-26(40)24(27(37)45-18-29)35-14-21(22(38)13-31)36-43-15-23(39)42-17-30(32,33)34/h2-12,24-25,27,35H,1,13-18H2/t24?,27-,29?/m1/s1 |
| InChIKey | QFFMRGCRPQAOTQ-QRXISGLASA-N |
| XLogP | 4.61 |
| TPSA | 123.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.91 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|