C35H35N3O7S — CID 67859848
(6R)-7-[(5-benzamido-6-benzhydryloxy-6-oxohexanoyl)amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid (PubChem CID 67859848) has the molecular formula C35H35N3O7S and a molecular weight of 641.75 g/mol. Its IUPAC name is (6R)-7-[(5-benzamido-6-benzhydryloxy-6-oxohexanoyl)amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid.
| Compound Name | (6R)-7-[(5-benzamido-6-benzhydryloxy-6-oxohexanoyl)amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
|---|---|
| PubChem CID | 67859848 |
| Molecular Formula | C35H35N3O7S |
| Molecular Weight | 641.75 g/mol |
| Exact Mass | 641.22 |
| IUPAC Name | (6R)-7-[(5-benzamido-6-benzhydryloxy-6-oxohexanoyl)amino]-3-ethenyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylic acid |
| SMILES | C=CC1(C(=O)O)CS[C@@H]2C(NC(=O)CCCC(NC(=O)c3ccccc3)C(=O)OC(c3ccccc3)c3ccccc3)C(=O)N2C1 |
| InChI | InChI=1S/C35H35N3O7S/c1-2-35(34(43)44)21-38-31(41)28(32(38)46-22-35)37-27(39)20-12-19-26(36-30(40)25-17-10-5-11-18-25)33(42)45-29(23-13-6-3-7-14-23)24-15-8-4-9-16-24/h2-11,13-18,26,28-29,32H,1,12,19-22H2,(H,36,40)(H,37,39)(H,43,44)/t26?,28?,32-,35?/m1/s1 |
| InChIKey | RBEHFZMLIGHJET-YCZCTXLWSA-N |
| XLogP | 3.94 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.75 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|