C32H32N2O4S2 — CID 67712928
benzhydryl (6R)-8-oxo-7-[(2-phenylacetyl)amino]-3-(prop-2-enylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate (PubChem CID 67712928) has the molecular formula C32H32N2O4S2 and a molecular weight of 572.75 g/mol. Its IUPAC name is benzhydryl (6R)-8-oxo-7-[(2-phenylacetyl)amino]-3-(prop-2-enylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate.
| Compound Name | benzhydryl (6R)-8-oxo-7-[(2-phenylacetyl)amino]-3-(prop-2-enylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
|---|---|
| PubChem CID | 67712928 |
| Molecular Formula | C32H32N2O4S2 |
| Molecular Weight | 572.75 g/mol |
| Exact Mass | 572.18 |
| IUPAC Name | benzhydryl (6R)-8-oxo-7-[(2-phenylacetyl)amino]-3-(prop-2-enylsulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
| SMILES | C=CCSCC1(C(=O)OC(c2ccccc2)c2ccccc2)CS[C@@H]2C(NC(=O)Cc3ccccc3)C(=O)N2C1 |
| InChI | InChI=1S/C32H32N2O4S2/c1-2-18-39-21-32(31(37)38-28(24-14-8-4-9-15-24)25-16-10-5-11-17-25)20-34-29(36)27(30(34)40-22-32)33-26(35)19-23-12-6-3-7-13-23/h2-17,27-28,30H,1,18-22H2,(H,33,35)/t27?,30-,32?/m1/s1 |
| InChIKey | KHWMZVSVMKKIGY-CPFODVRMSA-N |
| XLogP | 4.87 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.75 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|