C43H45N3O9S — CID 67859601
benzhydryl (6R)-7-[[6-benzhydryloxy-5-(ethoxycarbonylamino)-6-oxohexanoyl]amino]-3-hydroxy-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate (PubChem CID 67859601) has the molecular formula C43H45N3O9S and a molecular weight of 779.91 g/mol. Its IUPAC name is benzhydryl (6R)-7-[[6-benzhydryloxy-5-(ethoxycarbonylamino)-6-oxohexanoyl]amino]-3-hydroxy-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate.
| Compound Name | benzhydryl (6R)-7-[[6-benzhydryloxy-5-(ethoxycarbonylamino)-6-oxohexanoyl]amino]-3-hydroxy-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
|---|---|
| PubChem CID | 67859601 |
| Molecular Formula | C43H45N3O9S |
| Molecular Weight | 779.91 g/mol |
| Exact Mass | 779.29 |
| IUPAC Name | benzhydryl (6R)-7-[[6-benzhydryloxy-5-(ethoxycarbonylamino)-6-oxohexanoyl]amino]-3-hydroxy-4-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-carboxylate |
| SMILES | CCOC(=O)NC(CCCC(=O)NC1C(=O)N2CC(O)(C(=O)OC(c3ccccc3)c3ccccc3)C(C)S[C@H]12)C(=O)OC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C43H45N3O9S/c1-3-53-42(51)44-33(40(49)54-36(29-17-8-4-9-18-29)30-19-10-5-11-20-30)25-16-26-34(47)45-35-38(48)46-27-43(52,28(2)56-39(35)46)41(50)55-37(31-21-12-6-13-22-31)32-23-14-7-15-24-32/h4-15,17-24,28,33,35-37,39,52H,3,16,25-27H2,1-2H3,(H,44,51)(H,45,47)/t28?,33?,35?,39-,43?/m1/s1 |
| InChIKey | XDMXGHRLCXHBGT-QULUTZPESA-N |
| XLogP | 5.46 |
| TPSA | 160.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.91 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|