C14H19N4NaO4S — CID 88628135
sodium (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[4-(dimethylcarbamoyl)cyclohexyl]oxyiminoacetate (PubChem CID 88628135) has the molecular formula C14H19N4NaO4S and a molecular weight of 362.39 g/mol. Its IUPAC name is sodium (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[4-(dimethylcarbamoyl)cyclohexyl]oxyiminoacetate.
| Compound Name | sodium (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[4-(dimethylcarbamoyl)cyclohexyl]oxyiminoacetate |
|---|---|
| PubChem CID | 88628135 |
| Molecular Formula | C14H19N4NaO4S |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | sodium (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[4-(dimethylcarbamoyl)cyclohexyl]oxyiminoacetate |
| SMILES | CN(C)C(=O)C1CCC(O/N=C(\C(=O)[O-])c2csc(N)n2)CC1.[Na+] |
| InChI | InChI=1S/C14H20N4O4S.Na/c1-18(2)12(19)8-3-5-9(6-4-8)22-17-11(13(20)21)10-7-23-14(15)16-10;/h7-9H,3-6H2,1-2H3,(H2,15,16)(H,20,21);/q;+1/p-1/b17-11-; |
| InChIKey | CAPMFHBOUSIWSQ-CULRIWENSA-M |
| XLogP | -3.15 |
| TPSA | 120.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | -3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|