C22H26N6O3S — CID 166829530
(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[2-[4-[2-[3-(methylamino)propylamino]-4-pyridinyl]phenoxy]ethoxyimino]acetaldehyde (PubChem CID 166829530) has the molecular formula C22H26N6O3S and a molecular weight of 454.56 g/mol. Its IUPAC name is (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[2-[4-[2-[3-(methylamino)propylamino]-4-pyridinyl]phenoxy]ethoxyimino]acetaldehyde.
| Compound Name | (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[2-[4-[2-[3-(methylamino)propylamino]-4-pyridinyl]phenoxy]ethoxyimino]acetaldehyde |
|---|---|
| PubChem CID | 166829530 |
| Molecular Formula | C22H26N6O3S |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-[2-[4-[2-[3-(methylamino)propylamino]-4-pyridinyl]phenoxy]ethoxyimino]acetaldehyde |
| SMILES | CNCCCNc1cc(-c2ccc(OCCO/N=C(\C=O)c3csc(N)n3)cc2)ccn1 |
| InChI | InChI=1S/C22H26N6O3S/c1-24-8-2-9-25-21-13-17(7-10-26-21)16-3-5-18(6-4-16)30-11-12-31-28-19(14-29)20-15-32-22(23)27-20/h3-7,10,13-15,24H,2,8-9,11-12H2,1H3,(H2,23,27)(H,25,26)/b28-19+ |
| InChIKey | QZHNBXGADSEDQX-TURZUDJPSA-N |
| XLogP | 2.81 |
| TPSA | 123.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|