C12H11N3O3S — CID 139714453
benzyl 2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetate (PubChem CID 139714453) has the molecular formula C12H11N3O3S and a molecular weight of 277.31 g/mol. Its IUPAC name is benzyl 2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetate.
| Compound Name | benzyl 2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetate |
|---|---|
| PubChem CID | 139714453 |
| Molecular Formula | C12H11N3O3S |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | benzyl 2-(2-amino-1,3-thiazol-4-yl)-2-hydroxyiminoacetate |
| SMILES | Nc1nc(C(=NO)C(=O)OCc2ccccc2)cs1 |
| InChI | InChI=1S/C12H11N3O3S/c13-12-14-9(7-19-12)10(15-17)11(16)18-6-8-4-2-1-3-5-8/h1-5,7,17H,6H2,(H2,13,14) |
| InChIKey | OFGQRYDCMGMZLN-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|