C28H32N6O7S2 — CID 172939566
O-benzylhydroxylamine;ethyl 2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetate;ethyl (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-phenylmethoxyiminoacetate (PubChem CID 172939566) has the molecular formula C28H32N6O7S2 and a molecular weight of 628.73 g/mol. Its IUPAC name is O-benzylhydroxylamine;ethyl 2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetate;ethyl (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-phenylmethoxyiminoacetate.
| Compound Name | O-benzylhydroxylamine;ethyl 2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetate;ethyl (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-phenylmethoxyiminoacetate |
|---|---|
| PubChem CID | 172939566 |
| Molecular Formula | C28H32N6O7S2 |
| Molecular Weight | 628.73 g/mol |
| Exact Mass | 628.18 |
| IUPAC Name | O-benzylhydroxylamine;ethyl 2-(2-amino-1,3-thiazol-4-yl)-2-oxoacetate;ethyl (2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-phenylmethoxyiminoacetate |
| SMILES | CCOC(=O)/C(=N\OCc1ccccc1)c1csc(N)n1.CCOC(=O)C(=O)c1csc(N)n1.NOCc1ccccc1 |
| InChI | InChI=1S/C14H15N3O3S.C7H8N2O3S.C7H9NO/c1-2-19-13(18)12(11-9-21-14(15)16-11)17-20-8-10-6-4-3-5-7-10;1-2-12-6(11)5(10)4-3-13-7(8)9-4;8-9-6-7-4-2-1-3-5-7/h3-7,9H,2,8H2,1H3,(H2,15,16);3H,2H2,1H3,(H2,8,9);1-5H,6,8H2/b17-12-;; |
| InChIKey | TUIIUPXTPZYCMJ-GYMWKSPMSA-N |
| XLogP | 3.76 |
| TPSA | 204.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.73 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|