C14H24N4OS — CID 62788783
2-amino-N-[3-[cyclohexyl(methyl)amino]propyl]-1,3-thiazole-4-carboxamide (PubChem CID 62788783) has the molecular formula C14H24N4OS and a molecular weight of 296.44 g/mol. Its IUPAC name is 2-amino-N-[3-[cyclohexyl(methyl)amino]propyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-amino-N-[3-[cyclohexyl(methyl)amino]propyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 62788783 |
| Molecular Formula | C14H24N4OS |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 2-amino-N-[3-[cyclohexyl(methyl)amino]propyl]-1,3-thiazole-4-carboxamide |
| SMILES | CN(CCCNC(=O)c1csc(N)n1)C1CCCCC1 |
| InChI | InChI=1S/C14H24N4OS/c1-18(11-6-3-2-4-7-11)9-5-8-16-13(19)12-10-20-14(15)17-12/h10-11H,2-9H2,1H3,(H2,15,17)(H,16,19) |
| InChIKey | WILVGFZKGLYFJX-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|