C31H55N3O2 — CID 4094249
2-N,2-N,6-N,6-N-tetrahexylpyridine-2,6-dicarboxamide (PubChem CID 4094249) has the molecular formula C31H55N3O2 and a molecular weight of 501.80 g/mol. Its IUPAC name is 2-N,2-N,6-N,6-N-tetrahexylpyridine-2,6-dicarboxamide.
| Compound Name | 2-N,2-N,6-N,6-N-tetrahexylpyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 4094249 |
| Molecular Formula | C31H55N3O2 |
| Molecular Weight | 501.80 g/mol |
| Exact Mass | 501.43 |
| IUPAC Name | 2-N,2-N,6-N,6-N-tetrahexylpyridine-2,6-dicarboxamide |
| SMILES | CCCCCCN(CCCCCC)C(=O)c1cccc(C(=O)N(CCCCCC)CCCCCC)n1 |
| InChI | InChI=1S/C31H55N3O2/c1-5-9-13-17-24-33(25-18-14-10-6-2)30(35)28-22-21-23-29(32-28)31(36)34(26-19-15-11-7-3)27-20-16-12-8-4/h21-23H,5-20,24-27H2,1-4H3 |
| InChIKey | MTGOIABWNMKPLO-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.80 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|