C15H28N4O — CID 112733489
N,N-dihexyl-2H-triazole-4-carboxamide (PubChem CID 112733489) has the molecular formula C15H28N4O and a molecular weight of 280.42 g/mol. Its IUPAC name is N,N-dihexyl-2H-triazole-4-carboxamide.
| Compound Name | N,N-dihexyl-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 112733489 |
| Molecular Formula | C15H28N4O |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.23 |
| IUPAC Name | N,N-dihexyl-2H-triazole-4-carboxamide |
| SMILES | CCCCCCN(CCCCCC)C(=O)c1cn[nH]n1 |
| InChI | InChI=1S/C15H28N4O/c1-3-5-7-9-11-19(12-10-8-6-4-2)15(20)14-13-16-18-17-14/h13H,3-12H2,1-2H3,(H,16,17,18) |
| InChIKey | SOZXJQFZYRBJPA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|