C10H19N5O — CID 102978833
N-[3-(dimethylamino)propyl]-N-ethyl-2H-triazole-4-carboxamide (PubChem CID 102978833) has the molecular formula C10H19N5O and a molecular weight of 225.30 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-N-ethyl-2H-triazole-4-carboxamide.
| Compound Name | N-[3-(dimethylamino)propyl]-N-ethyl-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 102978833 |
| Molecular Formula | C10H19N5O |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-N-ethyl-2H-triazole-4-carboxamide |
| SMILES | CCN(CCCN(C)C)C(=O)c1cn[nH]n1 |
| InChI | InChI=1S/C10H19N5O/c1-4-15(7-5-6-14(2)3)10(16)9-8-11-13-12-9/h8H,4-7H2,1-3H3,(H,11,12,13) |
| InChIKey | ZEUWIKOOCXSTGZ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |