C8H14N4O2 — CID 112733352
N-ethyl-N-(2-methoxyethyl)-2H-triazole-4-carboxamide (PubChem CID 112733352) has the molecular formula C8H14N4O2 and a molecular weight of 198.23 g/mol. Its IUPAC name is N-ethyl-N-(2-methoxyethyl)-2H-triazole-4-carboxamide.
| Compound Name | N-ethyl-N-(2-methoxyethyl)-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 112733352 |
| Molecular Formula | C8H14N4O2 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | N-ethyl-N-(2-methoxyethyl)-2H-triazole-4-carboxamide |
| SMILES | CCN(CCOC)C(=O)c1cn[nH]n1 |
| InChI | InChI=1S/C8H14N4O2/c1-3-12(4-5-14-2)8(13)7-6-9-11-10-7/h6H,3-5H2,1-2H3,(H,9,10,11) |
| InChIKey | JFCAZAPHSSRNSV-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |