C7H12N4O2 — CID 112733912
N-(2-methoxyethyl)-N-methyl-2H-triazole-4-carboxamide (PubChem CID 112733912) has the molecular formula C7H12N4O2 and a molecular weight of 184.20 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N-methyl-2H-triazole-4-carboxamide.
| Compound Name | N-(2-methoxyethyl)-N-methyl-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 112733912 |
| Molecular Formula | C7H12N4O2 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | N-(2-methoxyethyl)-N-methyl-2H-triazole-4-carboxamide |
| SMILES | COCCN(C)C(=O)c1cn[nH]n1 |
| InChI | InChI=1S/C7H12N4O2/c1-11(3-4-13-2)7(12)6-5-8-10-9-6/h5H,3-4H2,1-2H3,(H,8,9,10) |
| InChIKey | HDBAFXZFAGGDPY-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |