C13H14N4O3 — CID 104547013
2-[2-[methyl(2H-triazole-4-carbonyl)amino]ethyl]benzoic acid (PubChem CID 104547013) has the molecular formula C13H14N4O3 and a molecular weight of 274.28 g/mol. Its IUPAC name is 2-[2-[methyl(2H-triazole-4-carbonyl)amino]ethyl]benzoic acid.
| Compound Name | 2-[2-[methyl(2H-triazole-4-carbonyl)amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 104547013 |
| Molecular Formula | C13H14N4O3 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 2-[2-[methyl(2H-triazole-4-carbonyl)amino]ethyl]benzoic acid |
| SMILES | CN(CCc1ccccc1C(=O)O)C(=O)c1cn[nH]n1 |
| InChI | InChI=1S/C13H14N4O3/c1-17(12(18)11-8-14-16-15-11)7-6-9-4-2-3-5-10(9)13(19)20/h2-5,8H,6-7H2,1H3,(H,19,20)(H,14,15,16) |
| InChIKey | LFFYCLMZELVXGP-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |