C15H15BrN2O3 — CID 104546873
2-[2-[(4-bromo-1H-pyrrole-2-carbonyl)-methylamino]ethyl]benzoic acid (PubChem CID 104546873) has the molecular formula C15H15BrN2O3 and a molecular weight of 351.20 g/mol. Its IUPAC name is 2-[2-[(4-bromo-1H-pyrrole-2-carbonyl)-methylamino]ethyl]benzoic acid.
| Compound Name | 2-[2-[(4-bromo-1H-pyrrole-2-carbonyl)-methylamino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 104546873 |
| Molecular Formula | C15H15BrN2O3 |
| Molecular Weight | 351.20 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | 2-[2-[(4-bromo-1H-pyrrole-2-carbonyl)-methylamino]ethyl]benzoic acid |
| SMILES | CN(CCc1ccccc1C(=O)O)C(=O)c1cc(Br)c[nH]1 |
| InChI | InChI=1S/C15H15BrN2O3/c1-18(14(19)13-8-11(16)9-17-13)7-6-10-4-2-3-5-12(10)15(20)21/h2-5,8-9,17H,6-7H2,1H3,(H,20,21) |
| InChIKey | OUYILQOWJWGICG-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.20 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |