C7H12N4OS — CID 112698098
N-methyl-N-(2-methylsulfanylethyl)-2H-triazole-4-carboxamide (PubChem CID 112698098) has the molecular formula C7H12N4OS and a molecular weight of 200.27 g/mol. Its IUPAC name is N-methyl-N-(2-methylsulfanylethyl)-2H-triazole-4-carboxamide.
| Compound Name | N-methyl-N-(2-methylsulfanylethyl)-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 112698098 |
| Molecular Formula | C7H12N4OS |
| Molecular Weight | 200.27 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | N-methyl-N-(2-methylsulfanylethyl)-2H-triazole-4-carboxamide |
| SMILES | CSCCN(C)C(=O)c1cn[nH]n1 |
| InChI | InChI=1S/C7H12N4OS/c1-11(3-4-13-2)7(12)6-5-8-10-9-6/h5H,3-4H2,1-2H3,(H,8,9,10) |
| InChIKey | ORGNPRLKPZUNPS-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.27 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |